C14H25NO5S — CID 104917748
ethyl 3,3-dimethyl-2-(3-methyl-1,1-dioxo-1,4-thiazinane-4-carbonyl)butanoate (PubChem CID 104917748) has the molecular formula C14H25NO5S and a molecular weight of 319.42 g/mol. Its IUPAC name is ethyl 3,3-dimethyl-2-(3-methyl-1,1-dioxo-1,4-thiazinane-4-carbonyl)butanoate.
| Compound Name | ethyl 3,3-dimethyl-2-(3-methyl-1,1-dioxo-1,4-thiazinane-4-carbonyl)butanoate |
|---|---|
| PubChem CID | 104917748 |
| Molecular Formula | C14H25NO5S |
| Molecular Weight | 319.42 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | ethyl 3,3-dimethyl-2-(3-methyl-1,1-dioxo-1,4-thiazinane-4-carbonyl)butanoate |
| SMILES | CCOC(=O)C(C(=O)N1CCS(=O)(=O)CC1C)C(C)(C)C |
| InChI | InChI=1S/C14H25NO5S/c1-6-20-13(17)11(14(3,4)5)12(16)15-7-8-21(18,19)9-10(15)2/h10-11H,6-9H2,1-5H3 |
| InChIKey | MQPRTDQVEURIHN-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.42 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|