C16H22FNO2 — CID 104917885
N-(4-ethylcyclohexyl)-2-fluoro-6-hydroxy-N-methylbenzamide (PubChem CID 104917885) has the molecular formula C16H22FNO2 and a molecular weight of 279.35 g/mol. Its IUPAC name is N-(4-ethylcyclohexyl)-2-fluoro-6-hydroxy-N-methylbenzamide.
| Compound Name | N-(4-ethylcyclohexyl)-2-fluoro-6-hydroxy-N-methylbenzamide |
|---|---|
| PubChem CID | 104917885 |
| Molecular Formula | C16H22FNO2 |
| Molecular Weight | 279.35 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | N-(4-ethylcyclohexyl)-2-fluoro-6-hydroxy-N-methylbenzamide |
| SMILES | CCC1CCC(N(C)C(=O)c2c(O)cccc2F)CC1 |
| InChI | InChI=1S/C16H22FNO2/c1-3-11-7-9-12(10-8-11)18(2)16(20)15-13(17)5-4-6-14(15)19/h4-6,11-12,19H,3,7-10H2,1-2H3 |
| InChIKey | NFOZWRJBULSQRQ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.35 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |