C14H15F2NO2 — CID 79120460
2,6-difluoro-N-methyl-N-(4-oxocyclohexyl)benzamide (PubChem CID 79120460) has the molecular formula C14H15F2NO2 and a molecular weight of 267.27 g/mol. Its IUPAC name is 2,6-difluoro-N-methyl-N-(4-oxocyclohexyl)benzamide.
| Compound Name | 2,6-difluoro-N-methyl-N-(4-oxocyclohexyl)benzamide |
|---|---|
| PubChem CID | 79120460 |
| Molecular Formula | C14H15F2NO2 |
| Molecular Weight | 267.27 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | 2,6-difluoro-N-methyl-N-(4-oxocyclohexyl)benzamide |
| SMILES | CN(C(=O)c1c(F)cccc1F)C1CCC(=O)CC1 |
| InChI | InChI=1S/C14H15F2NO2/c1-17(9-5-7-10(18)8-6-9)14(19)13-11(15)3-2-4-12(13)16/h2-4,9H,5-8H2,1H3 |
| InChIKey | RMEIGFWYOFCUHP-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.27 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |