C16H29NO3S — CID 104917906
ethyl 2-[(3-ethylsulfanylcyclopentyl)carbamoyl]-3,3-dimethylbutanoate (PubChem CID 104917906) has the molecular formula C16H29NO3S and a molecular weight of 315.48 g/mol. Its IUPAC name is ethyl 2-[(3-ethylsulfanylcyclopentyl)carbamoyl]-3,3-dimethylbutanoate.
| Compound Name | ethyl 2-[(3-ethylsulfanylcyclopentyl)carbamoyl]-3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 104917906 |
| Molecular Formula | C16H29NO3S |
| Molecular Weight | 315.48 g/mol |
| Exact Mass | 315.19 |
| IUPAC Name | ethyl 2-[(3-ethylsulfanylcyclopentyl)carbamoyl]-3,3-dimethylbutanoate |
| SMILES | CCOC(=O)C(C(=O)NC1CCC(SCC)C1)C(C)(C)C |
| InChI | InChI=1S/C16H29NO3S/c1-6-20-15(19)13(16(3,4)5)14(18)17-11-8-9-12(10-11)21-7-2/h11-13H,6-10H2,1-5H3,(H,17,18) |
| InChIKey | CRJPOPSGQPJILY-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.48 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|