C15H29NO3S — CID 104920171
ethyl 3,3-dimethyl-2-(5-methylsulfanylpentylcarbamoyl)butanoate (PubChem CID 104920171) has the molecular formula C15H29NO3S and a molecular weight of 303.47 g/mol. Its IUPAC name is ethyl 3,3-dimethyl-2-(5-methylsulfanylpentylcarbamoyl)butanoate.
| Compound Name | ethyl 3,3-dimethyl-2-(5-methylsulfanylpentylcarbamoyl)butanoate |
|---|---|
| PubChem CID | 104920171 |
| Molecular Formula | C15H29NO3S |
| Molecular Weight | 303.47 g/mol |
| Exact Mass | 303.19 |
| IUPAC Name | ethyl 3,3-dimethyl-2-(5-methylsulfanylpentylcarbamoyl)butanoate |
| SMILES | CCOC(=O)C(C(=O)NCCCCCSC)C(C)(C)C |
| InChI | InChI=1S/C15H29NO3S/c1-6-19-14(18)12(15(2,3)4)13(17)16-10-8-7-9-11-20-5/h12H,6-11H2,1-5H3,(H,16,17) |
| InChIKey | YFUUSHIVJDBEFG-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.47 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|