C16H22ClNO3 — CID 104918215
ethyl 2-[(2-chloro-5-methylphenyl)carbamoyl]-3,3-dimethylbutanoate (PubChem CID 104918215) has the molecular formula C16H22ClNO3 and a molecular weight of 311.81 g/mol. Its IUPAC name is ethyl 2-[(2-chloro-5-methylphenyl)carbamoyl]-3,3-dimethylbutanoate.
| Compound Name | ethyl 2-[(2-chloro-5-methylphenyl)carbamoyl]-3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 104918215 |
| Molecular Formula | C16H22ClNO3 |
| Molecular Weight | 311.81 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | ethyl 2-[(2-chloro-5-methylphenyl)carbamoyl]-3,3-dimethylbutanoate |
| SMILES | CCOC(=O)C(C(=O)Nc1cc(C)ccc1Cl)C(C)(C)C |
| InChI | InChI=1S/C16H22ClNO3/c1-6-21-15(20)13(16(3,4)5)14(19)18-12-9-10(2)7-8-11(12)17/h7-9,13H,6H2,1-5H3,(H,18,19) |
| InChIKey | JQPUXCACVOJEEJ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.81 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|