C15H19BrClNO3 — CID 116537647
ethyl 2-[(4-bromo-2-chlorophenyl)carbamoyl]-3,3-dimethylbutanoate (PubChem CID 116537647) has the molecular formula C15H19BrClNO3 and a molecular weight of 376.68 g/mol. Its IUPAC name is ethyl 2-[(4-bromo-2-chlorophenyl)carbamoyl]-3,3-dimethylbutanoate.
| Compound Name | ethyl 2-[(4-bromo-2-chlorophenyl)carbamoyl]-3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 116537647 |
| Molecular Formula | C15H19BrClNO3 |
| Molecular Weight | 376.68 g/mol |
| Exact Mass | 375.02 |
| IUPAC Name | ethyl 2-[(4-bromo-2-chlorophenyl)carbamoyl]-3,3-dimethylbutanoate |
| SMILES | CCOC(=O)C(C(=O)Nc1ccc(Br)cc1Cl)C(C)(C)C |
| InChI | InChI=1S/C15H19BrClNO3/c1-5-21-14(20)12(15(2,3)4)13(19)18-11-7-6-9(16)8-10(11)17/h6-8,12H,5H2,1-4H3,(H,18,19) |
| InChIKey | ZZQPFCTUTNPFKJ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.68 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|