C10H15ClN4O — CID 104918783
2-[(4-amino-6-chloro-2-pyridinyl)-methylamino]-N,N-dimethylacetamide (PubChem CID 104918783) has the molecular formula C10H15ClN4O and a molecular weight of 242.71 g/mol. Its IUPAC name is 2-[(4-amino-6-chloro-2-pyridinyl)-methylamino]-N,N-dimethylacetamide.
| Compound Name | 2-[(4-amino-6-chloro-2-pyridinyl)-methylamino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 104918783 |
| Molecular Formula | C10H15ClN4O |
| Molecular Weight | 242.71 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | 2-[(4-amino-6-chloro-2-pyridinyl)-methylamino]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)CN(C)c1cc(N)cc(Cl)n1 |
| InChI | InChI=1S/C10H15ClN4O/c1-14(2)10(16)6-15(3)9-5-7(12)4-8(11)13-9/h4-5H,6H2,1-3H3,(H2,12,13) |
| InChIKey | UZTTZTFKMYLEJZ-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.71 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|