C11H13ClN4S — CID 104924252
6-chloro-2-N-methyl-2-N-[(4-methyl-1,3-thiazol-5-yl)methyl]pyridine-2,4-diamine (PubChem CID 104924252) has the molecular formula C11H13ClN4S and a molecular weight of 268.77 g/mol. Its IUPAC name is 6-chloro-2-N-methyl-2-N-[(4-methyl-1,3-thiazol-5-yl)methyl]pyridine-2,4-diamine.
| Compound Name | 6-chloro-2-N-methyl-2-N-[(4-methyl-1,3-thiazol-5-yl)methyl]pyridine-2,4-diamine |
|---|---|
| PubChem CID | 104924252 |
| Molecular Formula | C11H13ClN4S |
| Molecular Weight | 268.77 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | 6-chloro-2-N-methyl-2-N-[(4-methyl-1,3-thiazol-5-yl)methyl]pyridine-2,4-diamine |
| SMILES | Cc1ncsc1CN(C)c1cc(N)cc(Cl)n1 |
| InChI | InChI=1S/C11H13ClN4S/c1-7-9(17-6-14-7)5-16(2)11-4-8(13)3-10(12)15-11/h3-4,6H,5H2,1-2H3,(H2,13,15) |
| InChIKey | SXBHXXGCUYUFKT-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.77 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|