C11H17N7S — CID 80839437
2-N,4-N,4-N-trimethyl-2-N-[(4-methyl-1,3-thiazol-5-yl)methyl]-1,3,5-triazine-2,4,6-triamine (PubChem CID 80839437) has the molecular formula C11H17N7S and a molecular weight of 279.37 g/mol. Its IUPAC name is 2-N,4-N,4-N-trimethyl-2-N-[(4-methyl-1,3-thiazol-5-yl)methyl]-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N,4-N,4-N-trimethyl-2-N-[(4-methyl-1,3-thiazol-5-yl)methyl]-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 80839437 |
| Molecular Formula | C11H17N7S |
| Molecular Weight | 279.37 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | 2-N,4-N,4-N-trimethyl-2-N-[(4-methyl-1,3-thiazol-5-yl)methyl]-1,3,5-triazine-2,4,6-triamine |
| SMILES | Cc1ncsc1CN(C)c1nc(N)nc(N(C)C)n1 |
| InChI | InChI=1S/C11H17N7S/c1-7-8(19-6-13-7)5-18(4)11-15-9(12)14-10(16-11)17(2)3/h6H,5H2,1-4H3,(H2,12,14,15,16) |
| InChIKey | OEOIYGGLMVQKSY-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 84.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.37 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |