C11H15BrN6S — CID 80805230
2-N-[(5-bromothiophen-3-yl)methyl]-2-N,4-N,4-N-trimethyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 80805230) has the molecular formula C11H15BrN6S and a molecular weight of 343.25 g/mol. Its IUPAC name is 2-N-[(5-bromothiophen-3-yl)methyl]-2-N,4-N,4-N-trimethyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N-[(5-bromothiophen-3-yl)methyl]-2-N,4-N,4-N-trimethyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 80805230 |
| Molecular Formula | C11H15BrN6S |
| Molecular Weight | 343.25 g/mol |
| Exact Mass | 342.03 |
| IUPAC Name | 2-N-[(5-bromothiophen-3-yl)methyl]-2-N,4-N,4-N-trimethyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | CN(C)c1nc(N)nc(N(C)Cc2csc(Br)c2)n1 |
| InChI | InChI=1S/C11H15BrN6S/c1-17(2)10-14-9(13)15-11(16-10)18(3)5-7-4-8(12)19-6-7/h4,6H,5H2,1-3H3,(H2,13,14,15,16) |
| InChIKey | VWWSFDPMCXLWBM-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.25 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |