C13H16BrN5S — CID 80963819
N-[(5-bromothiophen-3-yl)methyl]-2-cyclopropyl-6-hydrazinyl-N-methylpyrimidin-4-amine (PubChem CID 80963819) has the molecular formula C13H16BrN5S and a molecular weight of 354.28 g/mol. Its IUPAC name is N-[(5-bromothiophen-3-yl)methyl]-2-cyclopropyl-6-hydrazinyl-N-methylpyrimidin-4-amine.
| Compound Name | N-[(5-bromothiophen-3-yl)methyl]-2-cyclopropyl-6-hydrazinyl-N-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80963819 |
| Molecular Formula | C13H16BrN5S |
| Molecular Weight | 354.28 g/mol |
| Exact Mass | 353.03 |
| IUPAC Name | N-[(5-bromothiophen-3-yl)methyl]-2-cyclopropyl-6-hydrazinyl-N-methylpyrimidin-4-amine |
| SMILES | CN(Cc1csc(Br)c1)c1cc(NN)nc(C2CC2)n1 |
| InChI | InChI=1S/C13H16BrN5S/c1-19(6-8-4-10(14)20-7-8)12-5-11(18-15)16-13(17-12)9-2-3-9/h4-5,7,9H,2-3,6,15H2,1H3,(H,16,17,18) |
| InChIKey | ASBCTNJAIJZBIN-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.28 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|