C12H13BrN6S — CID 80904273
N-[(5-bromothiophen-3-yl)methyl]-6-hydrazinyl-N-methylimidazo[1,2-a]pyrazin-8-amine (PubChem CID 80904273) has the molecular formula C12H13BrN6S and a molecular weight of 353.25 g/mol. Its IUPAC name is N-[(5-bromothiophen-3-yl)methyl]-6-hydrazinyl-N-methylimidazo[1,2-a]pyrazin-8-amine.
| Compound Name | N-[(5-bromothiophen-3-yl)methyl]-6-hydrazinyl-N-methylimidazo[1,2-a]pyrazin-8-amine |
|---|---|
| PubChem CID | 80904273 |
| Molecular Formula | C12H13BrN6S |
| Molecular Weight | 353.25 g/mol |
| Exact Mass | 352.01 |
| IUPAC Name | N-[(5-bromothiophen-3-yl)methyl]-6-hydrazinyl-N-methylimidazo[1,2-a]pyrazin-8-amine |
| SMILES | CN(Cc1csc(Br)c1)c1nc(NN)cn2ccnc12 |
| InChI | InChI=1S/C12H13BrN6S/c1-18(5-8-4-9(13)20-7-8)12-11-15-2-3-19(11)6-10(16-12)17-14/h2-4,6-7,17H,5,14H2,1H3 |
| InChIKey | WEWUPHNMSCYEHD-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 71.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.25 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|