C12H14N6O — CID 80907040
N-(furan-2-ylmethyl)-6-hydrazinyl-N-methylimidazo[1,2-a]pyrazin-8-amine (PubChem CID 80907040) has the molecular formula C12H14N6O and a molecular weight of 258.29 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-6-hydrazinyl-N-methylimidazo[1,2-a]pyrazin-8-amine.
| Compound Name | N-(furan-2-ylmethyl)-6-hydrazinyl-N-methylimidazo[1,2-a]pyrazin-8-amine |
|---|---|
| PubChem CID | 80907040 |
| Molecular Formula | C12H14N6O |
| Molecular Weight | 258.29 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | N-(furan-2-ylmethyl)-6-hydrazinyl-N-methylimidazo[1,2-a]pyrazin-8-amine |
| SMILES | CN(Cc1ccco1)c1nc(NN)cn2ccnc12 |
| InChI | InChI=1S/C12H14N6O/c1-17(7-9-3-2-6-19-9)12-11-14-4-5-18(11)8-10(15-12)16-13/h2-6,8,16H,7,13H2,1H3 |
| InChIKey | OFXVNUGGLFFMJG-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 84.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.29 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|