C12H15N7S — CID 80912065
6-hydrazinyl-N-methyl-N-[(4-methyl-1,3-thiazol-5-yl)methyl]imidazo[1,2-a]pyrazin-8-amine (PubChem CID 80912065) has the molecular formula C12H15N7S and a molecular weight of 289.37 g/mol. Its IUPAC name is 6-hydrazinyl-N-methyl-N-[(4-methyl-1,3-thiazol-5-yl)methyl]imidazo[1,2-a]pyrazin-8-amine.
| Compound Name | 6-hydrazinyl-N-methyl-N-[(4-methyl-1,3-thiazol-5-yl)methyl]imidazo[1,2-a]pyrazin-8-amine |
|---|---|
| PubChem CID | 80912065 |
| Molecular Formula | C12H15N7S |
| Molecular Weight | 289.37 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | 6-hydrazinyl-N-methyl-N-[(4-methyl-1,3-thiazol-5-yl)methyl]imidazo[1,2-a]pyrazin-8-amine |
| SMILES | Cc1ncsc1CN(C)c1nc(NN)cn2ccnc12 |
| InChI | InChI=1S/C12H15N7S/c1-8-9(20-7-15-8)5-18(2)12-11-14-3-4-19(11)6-10(16-12)17-13/h3-4,6-7,17H,5,13H2,1-2H3 |
| InChIKey | SGFXUFVDSVXQLD-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 84.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.37 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|