C11H15BrFN3O — CID 104918997
5-bromo-3-fluoro-N-[(4-methylmorpholin-2-yl)methyl]pyridin-2-amine (PubChem CID 104918997) has the molecular formula C11H15BrFN3O and a molecular weight of 304.16 g/mol. Its IUPAC name is 5-bromo-3-fluoro-N-[(4-methylmorpholin-2-yl)methyl]pyridin-2-amine.
| Compound Name | 5-bromo-3-fluoro-N-[(4-methylmorpholin-2-yl)methyl]pyridin-2-amine |
|---|---|
| PubChem CID | 104918997 |
| Molecular Formula | C11H15BrFN3O |
| Molecular Weight | 304.16 g/mol |
| Exact Mass | 303.04 |
| IUPAC Name | 5-bromo-3-fluoro-N-[(4-methylmorpholin-2-yl)methyl]pyridin-2-amine |
| SMILES | CN1CCOC(CNc2ncc(Br)cc2F)C1 |
| InChI | InChI=1S/C11H15BrFN3O/c1-16-2-3-17-9(7-16)6-15-11-10(13)4-8(12)5-14-11/h4-5,9H,2-3,6-7H2,1H3,(H,14,15) |
| InChIKey | HOXKMCHVHLYUPX-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.16 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |