C8H11N3O2 — CID 104919327
1-(2-cyanoacetyl)pyrrolidine-3-carboxamide (PubChem CID 104919327) has the molecular formula C8H11N3O2 and a molecular weight of 181.19 g/mol. Its IUPAC name is 1-(2-cyanoacetyl)pyrrolidine-3-carboxamide.
| Compound Name | 1-(2-cyanoacetyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 104919327 |
| Molecular Formula | C8H11N3O2 |
| Molecular Weight | 181.19 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | 1-(2-cyanoacetyl)pyrrolidine-3-carboxamide |
| SMILES | N#CCC(=O)N1CCC(C(N)=O)C1 |
| InChI | InChI=1S/C8H11N3O2/c9-3-1-7(12)11-4-2-6(5-11)8(10)13/h6H,1-2,4-5H2,(H2,10,13) |
| InChIKey | UVJAHNRRWGLGLU-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 87.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.19 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |