C8H11N3O3 — CID 118077504
[1-(2-cyanoacetyl)pyrrolidin-3-yl]carbamic acid (PubChem CID 118077504) has the molecular formula C8H11N3O3 and a molecular weight of 197.19 g/mol. Its IUPAC name is [1-(2-cyanoacetyl)pyrrolidin-3-yl]carbamic acid.
| Compound Name | [1-(2-cyanoacetyl)pyrrolidin-3-yl]carbamic acid |
|---|---|
| PubChem CID | 118077504 |
| Molecular Formula | C8H11N3O3 |
| Molecular Weight | 197.19 g/mol |
| Exact Mass | 197.08 |
| IUPAC Name | [1-(2-cyanoacetyl)pyrrolidin-3-yl]carbamic acid |
| SMILES | N#CCC(=O)N1CCC(NC(=O)O)C1 |
| InChI | InChI=1S/C8H11N3O3/c9-3-1-7(12)11-4-2-6(5-11)10-8(13)14/h6,10H,1-2,4-5H2,(H,13,14) |
| InChIKey | JWNRHAAOLYSWBH-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 93.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.19 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |