C13H17BrN2O2 — CID 104920331
3-bromo-N-[2-[ethyl(methyl)amino]-2-oxoethyl]-4-methylbenzamide (PubChem CID 104920331) has the molecular formula C13H17BrN2O2 and a molecular weight of 313.19 g/mol. Its IUPAC name is 3-bromo-N-[2-[ethyl(methyl)amino]-2-oxoethyl]-4-methylbenzamide.
| Compound Name | 3-bromo-N-[2-[ethyl(methyl)amino]-2-oxoethyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 104920331 |
| Molecular Formula | C13H17BrN2O2 |
| Molecular Weight | 313.19 g/mol |
| Exact Mass | 312.05 |
| IUPAC Name | 3-bromo-N-[2-[ethyl(methyl)amino]-2-oxoethyl]-4-methylbenzamide |
| SMILES | CCN(C)C(=O)CNC(=O)c1ccc(C)c(Br)c1 |
| InChI | InChI=1S/C13H17BrN2O2/c1-4-16(3)12(17)8-15-13(18)10-6-5-9(2)11(14)7-10/h5-7H,4,8H2,1-3H3,(H,15,18) |
| InChIKey | CFBXWANVKOPFDC-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.19 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |