C16H16N2O2 — CID 10492110
3-benzyl-5-phenyl-1,3,5-oxadiazinan-4-one (PubChem CID 10492110) has the molecular formula C16H16N2O2 and a molecular weight of 268.32 g/mol. Its IUPAC name is 3-benzyl-5-phenyl-1,3,5-oxadiazinan-4-one.
| Compound Name | 3-benzyl-5-phenyl-1,3,5-oxadiazinan-4-one |
|---|---|
| PubChem CID | 10492110 |
| Molecular Formula | C16H16N2O2 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | 3-benzyl-5-phenyl-1,3,5-oxadiazinan-4-one |
| SMILES | O=C1N(Cc2ccccc2)COCN1c1ccccc1 |
| InChI | InChI=1S/C16H16N2O2/c19-16-17(11-14-7-3-1-4-8-14)12-20-13-18(16)15-9-5-2-6-10-15/h1-10H,11-13H2 |
| InChIKey | KGPDXALUFSYITH-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |