C19H35NO3 — CID 104921887
tert-butyl 4-ethyl-2-(2-hydroxy-5-methylcyclohexyl)piperidine-1-carboxylate (PubChem CID 104921887) has the molecular formula C19H35NO3 and a molecular weight of 325.49 g/mol. Its IUPAC name is tert-butyl 4-ethyl-2-(2-hydroxy-5-methylcyclohexyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-ethyl-2-(2-hydroxy-5-methylcyclohexyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 104921887 |
| Molecular Formula | C19H35NO3 |
| Molecular Weight | 325.49 g/mol |
| Exact Mass | 325.26 |
| IUPAC Name | tert-butyl 4-ethyl-2-(2-hydroxy-5-methylcyclohexyl)piperidine-1-carboxylate |
| SMILES | CCC1CCN(C(=O)OC(C)(C)C)C(C2CC(C)CCC2O)C1 |
| InChI | InChI=1S/C19H35NO3/c1-6-14-9-10-20(18(22)23-19(3,4)5)16(12-14)15-11-13(2)7-8-17(15)21/h13-17,21H,6-12H2,1-5H3 |
| InChIKey | QIQRGMTUURRQCI-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.49 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |