C15H19NOS — CID 104922908
(2R)-2-[(3-methylthiophen-2-yl)methylamino]-3-phenylpropan-1-ol (PubChem CID 104922908) has the molecular formula C15H19NOS and a molecular weight of 261.39 g/mol. Its IUPAC name is (2R)-2-[(3-methylthiophen-2-yl)methylamino]-3-phenylpropan-1-ol.
| Compound Name | (2R)-2-[(3-methylthiophen-2-yl)methylamino]-3-phenylpropan-1-ol |
|---|---|
| PubChem CID | 104922908 |
| Molecular Formula | C15H19NOS |
| Molecular Weight | 261.39 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | (2R)-2-[(3-methylthiophen-2-yl)methylamino]-3-phenylpropan-1-ol |
| SMILES | Cc1ccsc1CN[C@@H](CO)Cc1ccccc1 |
| InChI | InChI=1S/C15H19NOS/c1-12-7-8-18-15(12)10-16-14(11-17)9-13-5-3-2-4-6-13/h2-8,14,16-17H,9-11H2,1H3/t14-/m1/s1 |
| InChIKey | MNKXPESHRWZXAG-CQSZACIVSA-N |
| XLogP | 2.75 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.39 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |