C16H27BrN2O — CID 104924511
4-bromo-2-[1-[3-[methyl(propan-2-yl)amino]propylamino]propyl]phenol (PubChem CID 104924511) has the molecular formula C16H27BrN2O and a molecular weight of 343.31 g/mol. Its IUPAC name is 4-bromo-2-[1-[3-[methyl(propan-2-yl)amino]propylamino]propyl]phenol.
| Compound Name | 4-bromo-2-[1-[3-[methyl(propan-2-yl)amino]propylamino]propyl]phenol |
|---|---|
| PubChem CID | 104924511 |
| Molecular Formula | C16H27BrN2O |
| Molecular Weight | 343.31 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | 4-bromo-2-[1-[3-[methyl(propan-2-yl)amino]propylamino]propyl]phenol |
| SMILES | CCC(NCCCN(C)C(C)C)c1cc(Br)ccc1O |
| InChI | InChI=1S/C16H27BrN2O/c1-5-15(14-11-13(17)7-8-16(14)20)18-9-6-10-19(4)12(2)3/h7-8,11-12,15,18,20H,5-6,9-10H2,1-4H3 |
| InChIKey | QTSIDPCIHOCESK-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.31 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|