C11H13BrF3NO — CID 24705211
4-bromo-2-[1-(2,2,2-trifluoroethylamino)propyl]phenol (PubChem CID 24705211) has the molecular formula C11H13BrF3NO and a molecular weight of 312.13 g/mol. Its IUPAC name is 4-bromo-2-[1-(2,2,2-trifluoroethylamino)propyl]phenol.
| Compound Name | 4-bromo-2-[1-(2,2,2-trifluoroethylamino)propyl]phenol |
|---|---|
| PubChem CID | 24705211 |
| Molecular Formula | C11H13BrF3NO |
| Molecular Weight | 312.13 g/mol |
| Exact Mass | 311.01 |
| IUPAC Name | 4-bromo-2-[1-(2,2,2-trifluoroethylamino)propyl]phenol |
| SMILES | CCC(NCC(F)(F)F)c1cc(Br)ccc1O |
| InChI | InChI=1S/C11H13BrF3NO/c1-2-9(16-6-11(13,14)15)8-5-7(12)3-4-10(8)17/h3-5,9,16-17H,2,6H2,1H3 |
| InChIKey | AOUDALZRQRWONH-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.13 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|