C12H16BrF2NO2 — CID 104924965
4-bromo-2-[1-[(3,3-difluoro-2-hydroxypropyl)amino]propyl]phenol (PubChem CID 104924965) has the molecular formula C12H16BrF2NO2 and a molecular weight of 324.17 g/mol. Its IUPAC name is 4-bromo-2-[1-[(3,3-difluoro-2-hydroxypropyl)amino]propyl]phenol.
| Compound Name | 4-bromo-2-[1-[(3,3-difluoro-2-hydroxypropyl)amino]propyl]phenol |
|---|---|
| PubChem CID | 104924965 |
| Molecular Formula | C12H16BrF2NO2 |
| Molecular Weight | 324.17 g/mol |
| Exact Mass | 323.03 |
| IUPAC Name | 4-bromo-2-[1-[(3,3-difluoro-2-hydroxypropyl)amino]propyl]phenol |
| SMILES | CCC(NCC(O)C(F)F)c1cc(Br)ccc1O |
| InChI | InChI=1S/C12H16BrF2NO2/c1-2-9(16-6-11(18)12(14)15)8-5-7(13)3-4-10(8)17/h3-5,9,11-12,16-18H,2,6H2,1H3 |
| InChIKey | NSXGKUIYRMWRBN-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.17 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|