C15H22BrNO3 — CID 81462853
tert-butyl 2-[1-(5-bromo-2-hydroxyphenyl)propylamino]acetate (PubChem CID 81462853) has the molecular formula C15H22BrNO3 and a molecular weight of 344.25 g/mol. Its IUPAC name is tert-butyl 2-[1-(5-bromo-2-hydroxyphenyl)propylamino]acetate.
| Compound Name | tert-butyl 2-[1-(5-bromo-2-hydroxyphenyl)propylamino]acetate |
|---|---|
| PubChem CID | 81462853 |
| Molecular Formula | C15H22BrNO3 |
| Molecular Weight | 344.25 g/mol |
| Exact Mass | 343.08 |
| IUPAC Name | tert-butyl 2-[1-(5-bromo-2-hydroxyphenyl)propylamino]acetate |
| SMILES | CCC(NCC(=O)OC(C)(C)C)c1cc(Br)ccc1O |
| InChI | InChI=1S/C15H22BrNO3/c1-5-12(11-8-10(16)6-7-13(11)18)17-9-14(19)20-15(2,3)4/h6-8,12,17-18H,5,9H2,1-4H3 |
| InChIKey | RQRWKEVIGXXVJB-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.25 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|