C14H21BrN2O3 — CID 107237016
tert-butyl N-[1-(5-bromo-2-hydroxyphenyl)propylamino]carbamate (PubChem CID 107237016) has the molecular formula C14H21BrN2O3 and a molecular weight of 345.24 g/mol. Its IUPAC name is tert-butyl N-[1-(5-bromo-2-hydroxyphenyl)propylamino]carbamate.
| Compound Name | tert-butyl N-[1-(5-bromo-2-hydroxyphenyl)propylamino]carbamate |
|---|---|
| PubChem CID | 107237016 |
| Molecular Formula | C14H21BrN2O3 |
| Molecular Weight | 345.24 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | tert-butyl N-[1-(5-bromo-2-hydroxyphenyl)propylamino]carbamate |
| SMILES | CCC(NNC(=O)OC(C)(C)C)c1cc(Br)ccc1O |
| InChI | InChI=1S/C14H21BrN2O3/c1-5-11(10-8-9(15)6-7-12(10)18)16-17-13(19)20-14(2,3)4/h6-8,11,16,18H,5H2,1-4H3,(H,17,19) |
| InChIKey | QCOIUXVRWLORDK-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.24 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|