C12H22F3NO — CID 104925226
4-(6,6,6-trifluorohexan-2-ylamino)cyclohexan-1-ol (PubChem CID 104925226) has the molecular formula C12H22F3NO and a molecular weight of 253.31 g/mol. Its IUPAC name is 4-(6,6,6-trifluorohexan-2-ylamino)cyclohexan-1-ol.
| Compound Name | 4-(6,6,6-trifluorohexan-2-ylamino)cyclohexan-1-ol |
|---|---|
| PubChem CID | 104925226 |
| Molecular Formula | C12H22F3NO |
| Molecular Weight | 253.31 g/mol |
| Exact Mass | 253.17 |
| IUPAC Name | 4-(6,6,6-trifluorohexan-2-ylamino)cyclohexan-1-ol |
| SMILES | CC(CCCC(F)(F)F)NC1CCC(O)CC1 |
| InChI | InChI=1S/C12H22F3NO/c1-9(3-2-8-12(13,14)15)16-10-4-6-11(17)7-5-10/h9-11,16-17H,2-8H2,1H3 |
| InChIKey | YTGADZYIBVEBPX-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.31 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |