C14H20N4O — CID 104925300
2-methyl-N-[2-(oxan-2-yl)ethyl]pyrazolo[1,5-a]pyrazin-4-amine (PubChem CID 104925300) has the molecular formula C14H20N4O and a molecular weight of 260.34 g/mol. Its IUPAC name is 2-methyl-N-[2-(oxan-2-yl)ethyl]pyrazolo[1,5-a]pyrazin-4-amine.
| Compound Name | 2-methyl-N-[2-(oxan-2-yl)ethyl]pyrazolo[1,5-a]pyrazin-4-amine |
|---|---|
| PubChem CID | 104925300 |
| Molecular Formula | C14H20N4O |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | 2-methyl-N-[2-(oxan-2-yl)ethyl]pyrazolo[1,5-a]pyrazin-4-amine |
| SMILES | Cc1cc2c(NCCC3CCCCO3)nccn2n1 |
| InChI | InChI=1S/C14H20N4O/c1-11-10-13-14(16-7-8-18(13)17-11)15-6-5-12-4-2-3-9-19-12/h7-8,10,12H,2-6,9H2,1H3,(H,15,16) |
| InChIKey | VRWVXXOZHQZIQC-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 51.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |