C18H29NO — CID 104926144
(2R)-3-phenyl-2-[(2-propan-2-ylcyclohexyl)amino]propan-1-ol (PubChem CID 104926144) has the molecular formula C18H29NO and a molecular weight of 275.44 g/mol. Its IUPAC name is (2R)-3-phenyl-2-[(2-propan-2-ylcyclohexyl)amino]propan-1-ol.
| Compound Name | (2R)-3-phenyl-2-[(2-propan-2-ylcyclohexyl)amino]propan-1-ol |
|---|---|
| PubChem CID | 104926144 |
| Molecular Formula | C18H29NO |
| Molecular Weight | 275.44 g/mol |
| Exact Mass | 275.22 |
| IUPAC Name | (2R)-3-phenyl-2-[(2-propan-2-ylcyclohexyl)amino]propan-1-ol |
| SMILES | CC(C)C1CCCCC1N[C@@H](CO)Cc1ccccc1 |
| InChI | InChI=1S/C18H29NO/c1-14(2)17-10-6-7-11-18(17)19-16(13-20)12-15-8-4-3-5-9-15/h3-5,8-9,14,16-20H,6-7,10-13H2,1-2H3/t16-,17?,18?/m1/s1 |
| InChIKey | CMXDZYXBIPLOAZ-WWDZGPRUSA-N |
| XLogP | 3.39 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.44 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |