C16H21NO2 — CID 104927094
N-[(1R,2R)-2-hydroxycyclohexyl]-2,3-dihydro-1H-indene-5-carboxamide (PubChem CID 104927094) has the molecular formula C16H21NO2 and a molecular weight of 259.35 g/mol. Its IUPAC name is N-[(1R,2R)-2-hydroxycyclohexyl]-2,3-dihydro-1H-indene-5-carboxamide.
| Compound Name | N-[(1R,2R)-2-hydroxycyclohexyl]-2,3-dihydro-1H-indene-5-carboxamide |
|---|---|
| PubChem CID | 104927094 |
| Molecular Formula | C16H21NO2 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.16 |
| IUPAC Name | N-[(1R,2R)-2-hydroxycyclohexyl]-2,3-dihydro-1H-indene-5-carboxamide |
| SMILES | O=C(N[C@@H]1CCCC[C@H]1O)c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C16H21NO2/c18-15-7-2-1-6-14(15)17-16(19)13-9-8-11-4-3-5-12(11)10-13/h8-10,14-15,18H,1-7H2,(H,17,19)/t14-,15-/m1/s1 |
| InChIKey | HGEVOKSFYVUEKO-HUUCEWRRSA-N |
| XLogP | 2.21 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |