C15H20N2O2 — CID 107221941
N-[(1R,2R)-2-hydroxycyclohexyl]-2,3-dihydro-1H-indole-5-carboxamide (PubChem CID 107221941) has the molecular formula C15H20N2O2 and a molecular weight of 260.34 g/mol. Its IUPAC name is N-[(1R,2R)-2-hydroxycyclohexyl]-2,3-dihydro-1H-indole-5-carboxamide.
| Compound Name | N-[(1R,2R)-2-hydroxycyclohexyl]-2,3-dihydro-1H-indole-5-carboxamide |
|---|---|
| PubChem CID | 107221941 |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | N-[(1R,2R)-2-hydroxycyclohexyl]-2,3-dihydro-1H-indole-5-carboxamide |
| SMILES | O=C(N[C@@H]1CCCC[C@H]1O)c1ccc2c(c1)CCN2 |
| InChI | InChI=1S/C15H20N2O2/c18-14-4-2-1-3-13(14)17-15(19)11-5-6-12-10(9-11)7-8-16-12/h5-6,9,13-14,16,18H,1-4,7-8H2,(H,17,19)/t13-,14-/m1/s1 |
| InChIKey | RNPVPEXLHRHAPL-ZIAGYGMSSA-N |
| XLogP | 1.69 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |