C15H23NO2S — CID 104928219
methyl 2-[(5-methylsulfanylpentylamino)methyl]benzoate (PubChem CID 104928219) has the molecular formula C15H23NO2S and a molecular weight of 281.42 g/mol. Its IUPAC name is methyl 2-[(5-methylsulfanylpentylamino)methyl]benzoate.
| Compound Name | methyl 2-[(5-methylsulfanylpentylamino)methyl]benzoate |
|---|---|
| PubChem CID | 104928219 |
| Molecular Formula | C15H23NO2S |
| Molecular Weight | 281.42 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | methyl 2-[(5-methylsulfanylpentylamino)methyl]benzoate |
| SMILES | COC(=O)c1ccccc1CNCCCCCSC |
| InChI | InChI=1S/C15H23NO2S/c1-18-15(17)14-9-5-4-8-13(14)12-16-10-6-3-7-11-19-2/h4-5,8-9,16H,3,6-7,10-12H2,1-2H3 |
| InChIKey | ZCWJQSXEFHTJHL-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.42 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|