C19H19ClFNO4 — CID 104930300
5-(3-chloro-2-fluorophenyl)-4-(phenylmethoxycarbonylamino)pentanoic acid (PubChem CID 104930300) has the molecular formula C19H19ClFNO4 and a molecular weight of 379.82 g/mol. Its IUPAC name is 5-(3-chloro-2-fluorophenyl)-4-(phenylmethoxycarbonylamino)pentanoic acid.
| Compound Name | 5-(3-chloro-2-fluorophenyl)-4-(phenylmethoxycarbonylamino)pentanoic acid |
|---|---|
| PubChem CID | 104930300 |
| Molecular Formula | C19H19ClFNO4 |
| Molecular Weight | 379.82 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | 5-(3-chloro-2-fluorophenyl)-4-(phenylmethoxycarbonylamino)pentanoic acid |
| SMILES | O=C(O)CCC(Cc1cccc(Cl)c1F)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C19H19ClFNO4/c20-16-8-4-7-14(18(16)21)11-15(9-10-17(23)24)22-19(25)26-12-13-5-2-1-3-6-13/h1-8,15H,9-12H2,(H,22,25)(H,23,24) |
| InChIKey | QKXKVOAQMRDMKM-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.82 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |