C11H13F3N2O5 — CID 104930400
(2R)-2-[[4-(trifluoromethyl)-3,6-dihydro-2H-pyridine-1-carbonyl]amino]butanedioic acid (PubChem CID 104930400) has the molecular formula C11H13F3N2O5 and a molecular weight of 310.23 g/mol. Its IUPAC name is (2R)-2-[[4-(trifluoromethyl)-3,6-dihydro-2H-pyridine-1-carbonyl]amino]butanedioic acid.
| Compound Name | (2R)-2-[[4-(trifluoromethyl)-3,6-dihydro-2H-pyridine-1-carbonyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 104930400 |
| Molecular Formula | C11H13F3N2O5 |
| Molecular Weight | 310.23 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | (2R)-2-[[4-(trifluoromethyl)-3,6-dihydro-2H-pyridine-1-carbonyl]amino]butanedioic acid |
| SMILES | O=C(O)C[C@@H](NC(=O)N1CC=C(C(F)(F)F)CC1)C(=O)O |
| InChI | InChI=1S/C11H13F3N2O5/c12-11(13,14)6-1-3-16(4-2-6)10(21)15-7(9(19)20)5-8(17)18/h1,7H,2-5H2,(H,15,21)(H,17,18)(H,19,20)/t7-/m1/s1 |
| InChIKey | MEUCDOLEXSKJMR-SSDOTTSWSA-N |
| XLogP | 0.82 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.23 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|