C18H21F3N2O3 — CID 122028250
5-phenyl-4-[[4-(trifluoromethyl)-3,6-dihydro-2H-pyridine-1-carbonyl]amino]pentanoic acid (PubChem CID 122028250) has the molecular formula C18H21F3N2O3 and a molecular weight of 370.37 g/mol. Its IUPAC name is 5-phenyl-4-[[4-(trifluoromethyl)-3,6-dihydro-2H-pyridine-1-carbonyl]amino]pentanoic acid.
| Compound Name | 5-phenyl-4-[[4-(trifluoromethyl)-3,6-dihydro-2H-pyridine-1-carbonyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 122028250 |
| Molecular Formula | C18H21F3N2O3 |
| Molecular Weight | 370.37 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | 5-phenyl-4-[[4-(trifluoromethyl)-3,6-dihydro-2H-pyridine-1-carbonyl]amino]pentanoic acid |
| SMILES | O=C(O)CCC(Cc1ccccc1)NC(=O)N1CC=C(C(F)(F)F)CC1 |
| InChI | InChI=1S/C18H21F3N2O3/c19-18(20,21)14-8-10-23(11-9-14)17(26)22-15(6-7-16(24)25)12-13-4-2-1-3-5-13/h1-5,8,15H,6-7,9-12H2,(H,22,26)(H,24,25) |
| InChIKey | VGTWTWQMXXBPJE-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.37 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|