C15H20ClNO2 — CID 10493109
[(3S,4S)-4-(4-chlorophenyl)-1-methylpiperidin-3-yl]methyl acetate (PubChem CID 10493109) has the molecular formula C15H20ClNO2 and a molecular weight of 281.78 g/mol. Its IUPAC name is [(3S,4S)-4-(4-chlorophenyl)-1-methylpiperidin-3-yl]methyl acetate.
| Compound Name | [(3S,4S)-4-(4-chlorophenyl)-1-methylpiperidin-3-yl]methyl acetate |
|---|---|
| PubChem CID | 10493109 |
| Molecular Formula | C15H20ClNO2 |
| Molecular Weight | 281.78 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | [(3S,4S)-4-(4-chlorophenyl)-1-methylpiperidin-3-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@H]1CN(C)CC[C@@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H20ClNO2/c1-11(18)19-10-13-9-17(2)8-7-15(13)12-3-5-14(16)6-4-12/h3-6,13,15H,7-10H2,1-2H3/t13-,15+/m0/s1 |
| InChIKey | HJKKWIJTYBPLCJ-DZGCQCFKSA-N |
| XLogP | 2.94 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.78 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |