C17H29N3O3 — CID 104933457
tert-butyl 4-[2-amino-1-(5-methylfuran-2-yl)propyl]piperazine-1-carboxylate (PubChem CID 104933457) has the molecular formula C17H29N3O3 and a molecular weight of 323.44 g/mol. Its IUPAC name is tert-butyl 4-[2-amino-1-(5-methylfuran-2-yl)propyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-amino-1-(5-methylfuran-2-yl)propyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 104933457 |
| Molecular Formula | C17H29N3O3 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.22 |
| IUPAC Name | tert-butyl 4-[2-amino-1-(5-methylfuran-2-yl)propyl]piperazine-1-carboxylate |
| SMILES | Cc1ccc(C(C(C)N)N2CCN(C(=O)OC(C)(C)C)CC2)o1 |
| InChI | InChI=1S/C17H29N3O3/c1-12-6-7-14(22-12)15(13(2)18)19-8-10-20(11-9-19)16(21)23-17(3,4)5/h6-7,13,15H,8-11,18H2,1-5H3 |
| InChIKey | MGPGWBHMYYJOCM-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 71.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |