C14H27NO4S — CID 104937121
3-[1-(3,3-dimethylbutylsulfonyl)piperidin-3-yl]propanoic acid (PubChem CID 104937121) has the molecular formula C14H27NO4S and a molecular weight of 305.44 g/mol. Its IUPAC name is 3-[1-(3,3-dimethylbutylsulfonyl)piperidin-3-yl]propanoic acid.
| Compound Name | 3-[1-(3,3-dimethylbutylsulfonyl)piperidin-3-yl]propanoic acid |
|---|---|
| PubChem CID | 104937121 |
| Molecular Formula | C14H27NO4S |
| Molecular Weight | 305.44 g/mol |
| Exact Mass | 305.17 |
| IUPAC Name | 3-[1-(3,3-dimethylbutylsulfonyl)piperidin-3-yl]propanoic acid |
| SMILES | CC(C)(C)CCS(=O)(=O)N1CCCC(CCC(=O)O)C1 |
| InChI | InChI=1S/C14H27NO4S/c1-14(2,3)8-10-20(18,19)15-9-4-5-12(11-15)6-7-13(16)17/h12H,4-11H2,1-3H3,(H,16,17) |
| InChIKey | XIABDECEZWFCQO-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.44 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |