3-[1-(3,3-dimethylbutylsulfonyl)piperidin-3-yl]propanoic acid

C14H27NO4S — CID 104937121

IUPAC3-[1-(3,3-dimethylbutylsulfonyl)piperidin-3-yl]propanoic acid
SMILESCC(C)(C)CCS(=O)(=O)N1CCCC(CCC(=O)O)C1
InChIInChI=1S/C14H27NO4S/c1-14(2,3)8-10-20(18,19)15-9-4-5-12(11-15)6-7-13(16)17/h12H,4-11H2,1-3H3,(H,16,17)
InChIKeyXIABDECEZWFCQO-UHFFFAOYSA-N
MW305.44 g/mol
LogP2.33
Rot. Bonds6

About 3-[1-(3,3-dimethylbutylsulfonyl)piperidin-3-yl]propanoic acid

3-[1-(3,3-dimethylbutylsulfonyl)piperidin-3-yl]propanoic acid (PubChem CID 104937121) has the molecular formula C14H27NO4S and a molecular weight of 305.44 g/mol. Its IUPAC name is 3-[1-(3,3-dimethylbutylsulfonyl)piperidin-3-yl]propanoic acid.

Molecular Properties

Compound Name3-[1-(3,3-dimethylbutylsulfonyl)piperidin-3-yl]propanoic acid
PubChem CID104937121
Molecular FormulaC14H27NO4S
Molecular Weight305.44 g/mol
Exact Mass305.17
IUPAC Name3-[1-(3,3-dimethylbutylsulfonyl)piperidin-3-yl]propanoic acid
SMILESCC(C)(C)CCS(=O)(=O)N1CCCC(CCC(=O)O)C1
InChIInChI=1S/C14H27NO4S/c1-14(2,3)8-10-20(18,19)15-9-4-5-12(11-15)6-7-13(16)17/h12H,4-11H2,1-3H3,(H,16,17)
InChIKeyXIABDECEZWFCQO-UHFFFAOYSA-N
XLogP2.33
TPSA74.68 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500305.44
LogP ≤ 52.33
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 3-[1-(3,3-dimethylbutylsulfonyl)piperidin-3-yl]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[1-(3,3-dimethylbutylsulfonyl)piperidin-3-yl]propanoic acid?
The IUPAC name of 3-[1-(3,3-dimethylbutylsulfonyl)piperidin-3-yl]propanoic acid (CID 104937121) is 3-[1-(3,3-dimethylbutylsulfonyl)piperidin-3-yl]propanoic acid.
What is the SMILES notation for 3-[1-(3,3-dimethylbutylsulfonyl)piperidin-3-yl]propanoic acid?
The canonical SMILES for 3-[1-(3,3-dimethylbutylsulfonyl)piperidin-3-yl]propanoic acid is CC(C)(C)CCS(=O)(=O)N1CCCC(CCC(=O)O)C1.
What is the InChIKey of 3-[1-(3,3-dimethylbutylsulfonyl)piperidin-3-yl]propanoic acid?
The InChIKey is XIABDECEZWFCQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H27NO4S/c1-14(2,3)8-10-20(18,19)15-9-4-5-12(11-15)6-7-13(16)17/h12H,4-11H2,1-3H3,(H,16,17).
What are the key properties of 3-[1-(3,3-dimethylbutylsulfonyl)piperidin-3-yl]propanoic acid?
3-[1-(3,3-dimethylbutylsulfonyl)piperidin-3-yl]propanoic acid has a molecular weight of 305.44 g/mol, XLogP of 2.33, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1-(3,3-dimethylbutylsulfonyl)piperidin-3-yl]propanoic acid is sourced from PubChem (CID 104937121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).