C15H30N2O2S — CID 103832257
1-(3,3-dimethylbutylsulfonyl)-3-pyrrolidin-2-ylpiperidine (PubChem CID 103832257) has the molecular formula C15H30N2O2S and a molecular weight of 302.48 g/mol. Its IUPAC name is 1-(3,3-dimethylbutylsulfonyl)-3-pyrrolidin-2-ylpiperidine.
| Compound Name | 1-(3,3-dimethylbutylsulfonyl)-3-pyrrolidin-2-ylpiperidine |
|---|---|
| PubChem CID | 103832257 |
| Molecular Formula | C15H30N2O2S |
| Molecular Weight | 302.48 g/mol |
| Exact Mass | 302.20 |
| IUPAC Name | 1-(3,3-dimethylbutylsulfonyl)-3-pyrrolidin-2-ylpiperidine |
| SMILES | CC(C)(C)CCS(=O)(=O)N1CCCC(C2CCCN2)C1 |
| InChI | InChI=1S/C15H30N2O2S/c1-15(2,3)8-11-20(18,19)17-10-5-6-13(12-17)14-7-4-9-16-14/h13-14,16H,4-12H2,1-3H3 |
| InChIKey | YTABUVYFMGWXFJ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.48 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |