C12H24ClNO2S — CID 103521877
3-chloro-1-(3,3-dimethylbutylsulfonyl)-4-methylpiperidine (PubChem CID 103521877) has the molecular formula C12H24ClNO2S and a molecular weight of 281.85 g/mol. Its IUPAC name is 3-chloro-1-(3,3-dimethylbutylsulfonyl)-4-methylpiperidine.
| Compound Name | 3-chloro-1-(3,3-dimethylbutylsulfonyl)-4-methylpiperidine |
|---|---|
| PubChem CID | 103521877 |
| Molecular Formula | C12H24ClNO2S |
| Molecular Weight | 281.85 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | 3-chloro-1-(3,3-dimethylbutylsulfonyl)-4-methylpiperidine |
| SMILES | CC1CCN(S(=O)(=O)CCC(C)(C)C)CC1Cl |
| InChI | InChI=1S/C12H24ClNO2S/c1-10-5-7-14(9-11(10)13)17(15,16)8-6-12(2,3)4/h10-11H,5-9H2,1-4H3 |
| InChIKey | KOYRNBIAXOQAED-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.85 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|