C14H30O4Si — CID 10493749
1-[tert-butyl(dimethyl)silyl]oxy-2-hydroxy-2-(hydroxymethyl)-4,4-dimethylpentan-3-one (PubChem CID 10493749) has the molecular formula C14H30O4Si and a molecular weight of 290.48 g/mol. Its IUPAC name is 1-[tert-butyl(dimethyl)silyl]oxy-2-hydroxy-2-(hydroxymethyl)-4,4-dimethylpentan-3-one.
| Compound Name | 1-[tert-butyl(dimethyl)silyl]oxy-2-hydroxy-2-(hydroxymethyl)-4,4-dimethylpentan-3-one |
|---|---|
| PubChem CID | 10493749 |
| Molecular Formula | C14H30O4Si |
| Molecular Weight | 290.48 g/mol |
| Exact Mass | 290.19 |
| IUPAC Name | 1-[tert-butyl(dimethyl)silyl]oxy-2-hydroxy-2-(hydroxymethyl)-4,4-dimethylpentan-3-one |
| SMILES | CC(C)(C)C(=O)C(O)(CO)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H30O4Si/c1-12(2,3)11(16)14(17,9-15)10-18-19(7,8)13(4,5)6/h15,17H,9-10H2,1-8H3 |
| InChIKey | CCBVMMMVKNAJPV-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.48 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|