C15H18N2O3 — CID 104938860
N-(1-cyanocycloheptyl)-3,5-dihydroxybenzamide (PubChem CID 104938860) has the molecular formula C15H18N2O3 and a molecular weight of 274.32 g/mol. Its IUPAC name is N-(1-cyanocycloheptyl)-3,5-dihydroxybenzamide.
| Compound Name | N-(1-cyanocycloheptyl)-3,5-dihydroxybenzamide |
|---|---|
| PubChem CID | 104938860 |
| Molecular Formula | C15H18N2O3 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | N-(1-cyanocycloheptyl)-3,5-dihydroxybenzamide |
| SMILES | N#CC1(NC(=O)c2cc(O)cc(O)c2)CCCCCC1 |
| InChI | InChI=1S/C15H18N2O3/c16-10-15(5-3-1-2-4-6-15)17-14(20)11-7-12(18)9-13(19)8-11/h7-9,18-19H,1-6H2,(H,17,20) |
| InChIKey | CQOYOXVDKCIPMR-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 93.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |