About N-(1-cyanocyclohexyl)-3,4-dimethyl-5-sulfamoylbenzamide
N-(1-cyanocyclohexyl)-3,4-dimethyl-5-sulfamoylbenzamide (PubChem CID 86917827) has the molecular formula C16H21N3O3S
and a molecular weight of 335.43 g/mol. Its IUPAC name is N-(1-cyanocyclohexyl)-3,4-dimethyl-5-sulfamoylbenzamide.
Molecular Properties
| Compound Name | N-(1-cyanocyclohexyl)-3,4-dimethyl-5-sulfamoylbenzamide |
| PubChem CID | 86917827 |
| Molecular Formula | C16H21N3O3S |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | N-(1-cyanocyclohexyl)-3,4-dimethyl-5-sulfamoylbenzamide |
| SMILES | Cc1cc(C(=O)NC2(C#N)CCCCC2)cc(S(N)(=O)=O)c1C |
| InChI | InChI=1S/C16H21N3O3S/c1-11-8-13(9-14(12(11)2)23(18,21)22)15(20)19-16(10-17)6-4-3-5-7-16/h8-9H,3-7H2,1-2H3,(H,19,20)(H2,18,21,22) |
| InChIKey | BUSZEVZFDSFMDS-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 113.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(1-cyanocyclohexyl)-3,4-dimethyl-5-sulfamoylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-cyanocyclohexyl)-3,4-dimethyl-5-sulfamoylbenzamide?
The IUPAC name of N-(1-cyanocyclohexyl)-3,4-dimethyl-5-sulfamoylbenzamide (CID 86917827) is N-(1-cyanocyclohexyl)-3,4-dimethyl-5-sulfamoylbenzamide.
What is the SMILES notation for N-(1-cyanocyclohexyl)-3,4-dimethyl-5-sulfamoylbenzamide?
The canonical SMILES for N-(1-cyanocyclohexyl)-3,4-dimethyl-5-sulfamoylbenzamide is Cc1cc(C(=O)NC2(C#N)CCCCC2)cc(S(N)(=O)=O)c1C.
What is the InChIKey of N-(1-cyanocyclohexyl)-3,4-dimethyl-5-sulfamoylbenzamide?
The InChIKey is BUSZEVZFDSFMDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21N3O3S/c1-11-8-13(9-14(12(11)2)23(18,21)22)15(20)19-16(10-17)6-4-3-5-7-16/h8-9H,3-7H2,1-2H3,(H,19,20)(H2,18,21,22).
What are the key properties of N-(1-cyanocyclohexyl)-3,4-dimethyl-5-sulfamoylbenzamide?
N-(1-cyanocyclohexyl)-3,4-dimethyl-5-sulfamoylbenzamide has a molecular weight of 335.43 g/mol, XLogP of 1.91, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-cyanocyclohexyl)-3,4-dimethyl-5-sulfamoylbenzamide is sourced from PubChem (CID 86917827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).