About N-(1-cyclobutylethyl)-3,4-dimethyl-5-sulfamoylbenzamide
N-(1-cyclobutylethyl)-3,4-dimethyl-5-sulfamoylbenzamide (PubChem CID 115769138) has the molecular formula C15H22N2O3S
and a molecular weight of 310.42 g/mol. Its IUPAC name is N-(1-cyclobutylethyl)-3,4-dimethyl-5-sulfamoylbenzamide.
Molecular Properties
| Compound Name | N-(1-cyclobutylethyl)-3,4-dimethyl-5-sulfamoylbenzamide |
| PubChem CID | 115769138 |
| Molecular Formula | C15H22N2O3S |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | N-(1-cyclobutylethyl)-3,4-dimethyl-5-sulfamoylbenzamide |
| SMILES | Cc1cc(C(=O)NC(C)C2CCC2)cc(S(N)(=O)=O)c1C |
| InChI | InChI=1S/C15H22N2O3S/c1-9-7-13(8-14(10(9)2)21(16,19)20)15(18)17-11(3)12-5-4-6-12/h7-8,11-12H,4-6H2,1-3H3,(H,17,18)(H2,16,19,20) |
| InChIKey | BPUADYKFRPBVPH-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(1-cyclobutylethyl)-3,4-dimethyl-5-sulfamoylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-cyclobutylethyl)-3,4-dimethyl-5-sulfamoylbenzamide?
The IUPAC name of N-(1-cyclobutylethyl)-3,4-dimethyl-5-sulfamoylbenzamide (CID 115769138) is N-(1-cyclobutylethyl)-3,4-dimethyl-5-sulfamoylbenzamide.
What is the SMILES notation for N-(1-cyclobutylethyl)-3,4-dimethyl-5-sulfamoylbenzamide?
The canonical SMILES for N-(1-cyclobutylethyl)-3,4-dimethyl-5-sulfamoylbenzamide is Cc1cc(C(=O)NC(C)C2CCC2)cc(S(N)(=O)=O)c1C.
What is the InChIKey of N-(1-cyclobutylethyl)-3,4-dimethyl-5-sulfamoylbenzamide?
The InChIKey is BPUADYKFRPBVPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N2O3S/c1-9-7-13(8-14(10(9)2)21(16,19)20)15(18)17-11(3)12-5-4-6-12/h7-8,11-12H,4-6H2,1-3H3,(H,17,18)(H2,16,19,20).
What are the key properties of N-(1-cyclobutylethyl)-3,4-dimethyl-5-sulfamoylbenzamide?
N-(1-cyclobutylethyl)-3,4-dimethyl-5-sulfamoylbenzamide has a molecular weight of 310.42 g/mol, XLogP of 1.87, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-cyclobutylethyl)-3,4-dimethyl-5-sulfamoylbenzamide is sourced from PubChem (CID 115769138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).