C18H15NOS — CID 10493963
3-(4-methoxyphenyl)-4-methylthieno[3,4-b]indole (PubChem CID 10493963) has the molecular formula C18H15NOS and a molecular weight of 293.39 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-4-methylthieno[3,4-b]indole.
| Compound Name | 3-(4-methoxyphenyl)-4-methylthieno[3,4-b]indole |
|---|---|
| PubChem CID | 10493963 |
| Molecular Formula | C18H15NOS |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | 3-(4-methoxyphenyl)-4-methylthieno[3,4-b]indole |
| SMILES | COc1ccc(-c2scc3c4ccccc4n(C)c23)cc1 |
| InChI | InChI=1S/C18H15NOS/c1-19-16-6-4-3-5-14(16)15-11-21-18(17(15)19)12-7-9-13(20-2)10-8-12/h3-11H,1-2H3 |
| InChIKey | JUDBVQAMRVESIT-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |