C19H34N2O2 — CID 104940083
tert-butyl 2-[2-(2-methylprop-2-enylamino)cyclohexyl]pyrrolidine-1-carboxylate (PubChem CID 104940083) has the molecular formula C19H34N2O2 and a molecular weight of 322.49 g/mol. Its IUPAC name is tert-butyl 2-[2-(2-methylprop-2-enylamino)cyclohexyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[2-(2-methylprop-2-enylamino)cyclohexyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 104940083 |
| Molecular Formula | C19H34N2O2 |
| Molecular Weight | 322.49 g/mol |
| Exact Mass | 322.26 |
| IUPAC Name | tert-butyl 2-[2-(2-methylprop-2-enylamino)cyclohexyl]pyrrolidine-1-carboxylate |
| SMILES | C=C(C)CNC1CCCCC1C1CCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H34N2O2/c1-14(2)13-20-16-10-7-6-9-15(16)17-11-8-12-21(17)18(22)23-19(3,4)5/h15-17,20H,1,6-13H2,2-5H3 |
| InChIKey | UFCZLHUUWQVUNC-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.49 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|