C21H40N2O2 — CID 113248518
tert-butyl 2-[2-(heptan-2-ylamino)cyclopentyl]pyrrolidine-1-carboxylate (PubChem CID 113248518) has the molecular formula C21H40N2O2 and a molecular weight of 352.56 g/mol. Its IUPAC name is tert-butyl 2-[2-(heptan-2-ylamino)cyclopentyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[2-(heptan-2-ylamino)cyclopentyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 113248518 |
| Molecular Formula | C21H40N2O2 |
| Molecular Weight | 352.56 g/mol |
| Exact Mass | 352.31 |
| IUPAC Name | tert-butyl 2-[2-(heptan-2-ylamino)cyclopentyl]pyrrolidine-1-carboxylate |
| SMILES | CCCCCC(C)NC1CCCC1C1CCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H40N2O2/c1-6-7-8-11-16(2)22-18-13-9-12-17(18)19-14-10-15-23(19)20(24)25-21(3,4)5/h16-19,22H,6-15H2,1-5H3 |
| InChIKey | BPQWQRLJBJTRCH-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.56 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|