C7H10F3N3 — CID 104941818
(1R)-1-[3-(2,2,2-trifluoroethyl)imidazol-4-yl]ethanamine (PubChem CID 104941818) has the molecular formula C7H10F3N3 and a molecular weight of 193.17 g/mol. Its IUPAC name is (1R)-1-[3-(2,2,2-trifluoroethyl)imidazol-4-yl]ethanamine.
| Compound Name | (1R)-1-[3-(2,2,2-trifluoroethyl)imidazol-4-yl]ethanamine |
|---|---|
| PubChem CID | 104941818 |
| Molecular Formula | C7H10F3N3 |
| Molecular Weight | 193.17 g/mol |
| Exact Mass | 193.08 |
| IUPAC Name | (1R)-1-[3-(2,2,2-trifluoroethyl)imidazol-4-yl]ethanamine |
| SMILES | C[C@@H](N)c1cncn1CC(F)(F)F |
| InChI | InChI=1S/C7H10F3N3/c1-5(11)6-2-12-4-13(6)3-7(8,9)10/h2,4-5H,3,11H2,1H3/t5-/m1/s1 |
| InChIKey | RMOQWSBJPBFMGQ-RXMQYKEDSA-N |
| XLogP | 1.47 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.17 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |