C11H21N3 — CID 104943294
(1R)-1-[3-(2,3-dimethylbutyl)imidazol-4-yl]ethanamine (PubChem CID 104943294) has the molecular formula C11H21N3 and a molecular weight of 195.31 g/mol. Its IUPAC name is (1R)-1-[3-(2,3-dimethylbutyl)imidazol-4-yl]ethanamine.
| Compound Name | (1R)-1-[3-(2,3-dimethylbutyl)imidazol-4-yl]ethanamine |
|---|---|
| PubChem CID | 104943294 |
| Molecular Formula | C11H21N3 |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.17 |
| IUPAC Name | (1R)-1-[3-(2,3-dimethylbutyl)imidazol-4-yl]ethanamine |
| SMILES | CC(C)C(C)Cn1cncc1[C@@H](C)N |
| InChI | InChI=1S/C11H21N3/c1-8(2)9(3)6-14-7-13-5-11(14)10(4)12/h5,7-10H,6,12H2,1-4H3/t9?,10-/m1/s1 |
| InChIKey | IDLJJZXBWGZBRO-QVDQXJPCSA-N |
| XLogP | 2.19 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |